C39H55F5O7 — CID 18544021
11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoic acid (PubChem CID 18544021) has the molecular formula C39H55F5O7 and a molecular weight of 730.85 g/mol. Its IUPAC name is 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoic acid.
| Compound Name | 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoic acid |
|---|---|
| PubChem CID | 18544021 |
| Molecular Formula | C39H55F5O7 |
| Molecular Weight | 730.85 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoic acid |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCCCCCCC(CCCCCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C39H55F5O7/c1-37(30-18-20-31(21-19-30)50-27-47-2)26-49-35-25-32(51-28-48-3)22-23-33(35)34(37)17-13-8-6-4-5-7-11-15-29(36(45)46)16-12-9-10-14-24-38(40,41)39(42,43)44/h18-23,25,29,34H,4-17,24,26-28H2,1-3H3,(H,45,46) |
| InChIKey | GFPAMEKDWYJLNX-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.85 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|