C19H31F5O2 — CID 18544024
methyl 2-(7,7,8,8,8-pentafluorooctyl)dec-9-enoate (PubChem CID 18544024) has the molecular formula C19H31F5O2 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 2-(7,7,8,8,8-pentafluorooctyl)dec-9-enoate.
| Compound Name | methyl 2-(7,7,8,8,8-pentafluorooctyl)dec-9-enoate |
|---|---|
| PubChem CID | 18544024 |
| Molecular Formula | C19H31F5O2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methyl 2-(7,7,8,8,8-pentafluorooctyl)dec-9-enoate |
| SMILES | C=CCCCCCCC(CCCCCCC(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C19H31F5O2/c1-3-4-5-6-7-10-13-16(17(25)26-2)14-11-8-9-12-15-18(20,21)19(22,23)24/h3,16H,1,4-15H2,2H3 |
| InChIKey | UJACITYNRRUOAF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|