C9H7Cl2F6N3O2 — CID 18544802
[3,5-dichloro-4,6-bis(2,2,2-trifluoroethoxy)-2-pyridinyl]hydrazine (PubChem CID 18544802) has the molecular formula C9H7Cl2F6N3O2 and a molecular weight of 374.07 g/mol. Its IUPAC name is [3,5-dichloro-4,6-bis(2,2,2-trifluoroethoxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-4,6-bis(2,2,2-trifluoroethoxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 18544802 |
| Molecular Formula | C9H7Cl2F6N3O2 |
| Molecular Weight | 374.07 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | [3,5-dichloro-4,6-bis(2,2,2-trifluoroethoxy)-2-pyridinyl]hydrazine |
| SMILES | NNc1nc(OCC(F)(F)F)c(Cl)c(OCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H7Cl2F6N3O2/c10-3-5(21-1-8(12,13)14)4(11)7(19-6(3)20-18)22-2-9(15,16)17/h1-2,18H2,(H,19,20) |
| InChIKey | WUHCHGUADDVHSU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.07 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|