C15H23Cl2N3O — CID 18545021
2-amino-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-methylbutan-1-one;hydrochloride (PubChem CID 18545021) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-amino-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-methylbutan-1-one;hydrochloride.
| Compound Name | 2-amino-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-methylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 18545021 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-amino-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-methylbutan-1-one;hydrochloride |
| SMILES | CC(C)C(N)C(=O)N1CCN(c2ccccc2Cl)CC1.Cl |
| InChI | InChI=1S/C15H22ClN3O.ClH/c1-11(2)14(17)15(20)19-9-7-18(8-10-19)13-6-4-3-5-12(13)16;/h3-6,11,14H,7-10,17H2,1-2H3;1H |
| InChIKey | AIGLAEAXRHZVJT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |