C17H28ClN3O2 — CID 18545089
2-amino-1-[4-(4-methoxyphenyl)piperazin-1-yl]-4-methylpentan-1-one;hydrochloride (PubChem CID 18545089) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is 2-amino-1-[4-(4-methoxyphenyl)piperazin-1-yl]-4-methylpentan-1-one;hydrochloride.
| Compound Name | 2-amino-1-[4-(4-methoxyphenyl)piperazin-1-yl]-4-methylpentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 18545089 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-amino-1-[4-(4-methoxyphenyl)piperazin-1-yl]-4-methylpentan-1-one;hydrochloride |
| SMILES | COc1ccc(N2CCN(C(=O)C(N)CC(C)C)CC2)cc1.Cl |
| InChI | InChI=1S/C17H27N3O2.ClH/c1-13(2)12-16(18)17(21)20-10-8-19(9-11-20)14-4-6-15(22-3)7-5-14;/h4-7,13,16H,8-12,18H2,1-3H3;1H |
| InChIKey | DDYTXPCSSKHCQU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|