About 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine
4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 18545468) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine |
| PubChem CID | 18545468 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | Brc1ccc(C2=CCNCC2)cc1 |
| InChI | InChI=1S/C11H12BrN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2 |
| InChIKey | FDRGGAPHXGEHPI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine?
The IUPAC name of 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine (CID 18545468) is 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine is Brc1ccc(C2=CCNCC2)cc1.
What is the InChIKey of 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine?
The InChIKey is FDRGGAPHXGEHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2.
What are the key properties of 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine?
4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine has a molecular weight of 238.13 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 18545468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).