C21H20F4N6O — CID 18545633
4-(6-piperazin-1-yl-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 18545633) has the molecular formula C21H20F4N6O and a molecular weight of 448.42 g/mol. Its IUPAC name is 4-(6-piperazin-1-yl-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(6-piperazin-1-yl-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 18545633 |
| Molecular Formula | C21H20F4N6O |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-(6-piperazin-1-yl-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3ccc(N4CCNCC4)nc3)n2)c1 |
| InChI | InChI=1S/C21H20F4N6O/c22-19(23)21(24,25)32-16-3-1-2-15(12-16)29-20-27-7-6-17(30-20)14-4-5-18(28-13-14)31-10-8-26-9-11-31/h1-7,12-13,19,26H,8-11H2,(H,27,29,30) |
| InChIKey | XBBMYUJVJKHDOC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|