About 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile
2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile (PubChem CID 18545771) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile |
| PubChem CID | 18545771 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NCC(=O)N2 |
| InChI | InChI=1S/C9H7N3O/c10-4-6-1-2-7-8(3-6)11-5-9(13)12-7/h1-3,11H,5H2,(H,12,13) |
| InChIKey | VCQBDEDRWMCMMN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile?
The IUPAC name of 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile (CID 18545771) is 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile.
What is the SMILES notation for 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile?
The canonical SMILES for 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile is N#Cc1ccc2c(c1)NCC(=O)N2.
What is the InChIKey of 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile?
The InChIKey is VCQBDEDRWMCMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c10-4-6-1-2-7-8(3-6)11-5-9(13)12-7/h1-3,11H,5H2,(H,12,13).
What are the key properties of 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile?
2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile has a molecular weight of 173.17 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3,4-dihydro-1H-quinoxaline-6-carbonitrile is sourced from PubChem (CID 18545771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).