C24H22F4N2O3S — CID 18545904
[1-[[4-(5-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate (PubChem CID 18545904) has the molecular formula C24H22F4N2O3S and a molecular weight of 494.51 g/mol. Its IUPAC name is [1-[[4-(5-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate.
| Compound Name | [1-[[4-(5-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18545904 |
| Molecular Formula | C24H22F4N2O3S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [1-[[4-(5-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CCC2CN1CC=C(c2c[nH]c3ccc(F)cc23)CC1)C(F)(F)F |
| InChI | InChI=1S/C24H22F4N2O3S/c25-18-3-6-23-21(12-18)22(13-29-23)15-7-9-30(10-8-15)14-17-2-1-16-11-19(4-5-20(16)17)33-34(31,32)24(26,27)28/h3-7,11-13,17,29H,1-2,8-10,14H2 |
| InChIKey | WHCGIFUISGAANT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|