C22H16N2O7S — CID 18546055
[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] acetate (PubChem CID 18546055) has the molecular formula C22H16N2O7S and a molecular weight of 452.44 g/mol. Its IUPAC name is [2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] acetate.
| Compound Name | [2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 18546055 |
| Molecular Formula | C22H16N2O7S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] acetate |
| SMILES | CC(=O)Oc1cccc2oc(C(=O)Nc3ccc(CC4SC(=O)NC4=O)cc3)cc(=O)c12 |
| InChI | InChI=1S/C22H16N2O7S/c1-11(25)30-15-3-2-4-16-19(15)14(26)10-17(31-16)20(27)23-13-7-5-12(6-8-13)9-18-21(28)24-22(29)32-18/h2-8,10,18H,9H2,1H3,(H,23,27)(H,24,28,29) |
| InChIKey | PUMJBFPMHOMPEE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|