C39H55F5O4S — CID 18546256
ethyl 2-[8-[3-ethyl-7-methoxy-3-(4-methoxyphenyl)-2,4-dihydrothiochromen-4-yl]octyl]-9,9,10,10,10-pentafluorodecanoate (PubChem CID 18546256) has the molecular formula C39H55F5O4S and a molecular weight of 714.92 g/mol. Its IUPAC name is ethyl 2-[8-[3-ethyl-7-methoxy-3-(4-methoxyphenyl)-2,4-dihydrothiochromen-4-yl]octyl]-9,9,10,10,10-pentafluorodecanoate.
| Compound Name | ethyl 2-[8-[3-ethyl-7-methoxy-3-(4-methoxyphenyl)-2,4-dihydrothiochromen-4-yl]octyl]-9,9,10,10,10-pentafluorodecanoate |
|---|---|
| PubChem CID | 18546256 |
| Molecular Formula | C39H55F5O4S |
| Molecular Weight | 714.92 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | ethyl 2-[8-[3-ethyl-7-methoxy-3-(4-methoxyphenyl)-2,4-dihydrothiochromen-4-yl]octyl]-9,9,10,10,10-pentafluorodecanoate |
| SMILES | CCOC(=O)C(CCCCCCCCC1c2ccc(OC)cc2SCC1(CC)c1ccc(OC)cc1)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C39H55F5O4S/c1-5-37(30-20-22-31(46-3)23-21-30)28-49-35-27-32(47-4)24-25-33(35)34(37)19-15-10-8-7-9-13-17-29(36(45)48-6-2)18-14-11-12-16-26-38(40,41)39(42,43)44/h20-25,27,29,34H,5-19,26,28H2,1-4H3 |
| InChIKey | CRNLRZIBAFPRHX-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.92 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|