C17H27F5O2 — CID 18546257
ethyl 2-(5,5,6,6,6-pentafluorohexyl)non-8-enoate (PubChem CID 18546257) has the molecular formula C17H27F5O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2-(5,5,6,6,6-pentafluorohexyl)non-8-enoate.
| Compound Name | ethyl 2-(5,5,6,6,6-pentafluorohexyl)non-8-enoate |
|---|---|
| PubChem CID | 18546257 |
| Molecular Formula | C17H27F5O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ethyl 2-(5,5,6,6,6-pentafluorohexyl)non-8-enoate |
| SMILES | C=CCCCCCC(CCCCC(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C17H27F5O2/c1-3-5-6-7-8-11-14(15(23)24-4-2)12-9-10-13-16(18,19)17(20,21)22/h3,14H,1,4-13H2,2H3 |
| InChIKey | LIGRGLCUWJULCK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|