C42H61F5O7 — CID 18546270
ethyl 11-[3-ethyl-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate (PubChem CID 18546270) has the molecular formula C42H61F5O7 and a molecular weight of 772.93 g/mol. Its IUPAC name is ethyl 11-[3-ethyl-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate.
| Compound Name | ethyl 11-[3-ethyl-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate |
|---|---|
| PubChem CID | 18546270 |
| Molecular Formula | C42H61F5O7 |
| Molecular Weight | 772.93 g/mol |
| Exact Mass | 772.43 |
| IUPAC Name | ethyl 11-[3-ethyl-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-2,4-dihydrochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate |
| SMILES | CCOC(=O)C(CCCCCCCCCC1c2ccc(OCOC)cc2OCC1(CC)c1ccc(OCOC)cc1)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C42H61F5O7/c1-5-40(33-21-23-34(24-22-33)53-30-49-3)29-52-38-28-35(54-31-50-4)25-26-36(38)37(40)20-16-11-9-7-8-10-14-18-32(39(48)51-6-2)19-15-12-13-17-27-41(43,44)42(45,46)47/h21-26,28,32,37H,5-20,27,29-31H2,1-4H3 |
| InChIKey | DNABLWKRXSPXTI-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.93 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|