C38H49F9O7 — CID 18546290
ethyl 10-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate (PubChem CID 18546290) has the molecular formula C38H49F9O7 and a molecular weight of 788.78 g/mol. Its IUPAC name is ethyl 10-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate.
| Compound Name | ethyl 10-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate |
|---|---|
| PubChem CID | 18546290 |
| Molecular Formula | C38H49F9O7 |
| Molecular Weight | 788.78 g/mol |
| Exact Mass | 788.33 |
| IUPAC Name | ethyl 10-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate |
| SMILES | CCOC(=O)C(CCCCCCCCC1c2ccc(OCOC)cc2OCC1(C)c1ccc(OCOC)cc1)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C38H49F9O7/c1-5-51-33(48)26(20-21-35(39,40)36(41,42)37(43,44)38(45,46)47)12-10-8-6-7-9-11-13-31-30-19-18-29(54-25-50-4)22-32(30)52-23-34(31,2)27-14-16-28(17-15-27)53-24-49-3/h14-19,22,26,31H,5-13,20-21,23-25H2,1-4H3 |
| InChIKey | RKSJATWJKCXTQN-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.78 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|