C36H45F9O4S — CID 18546296
ethyl 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate (PubChem CID 18546296) has the molecular formula C36H45F9O4S and a molecular weight of 744.80 g/mol. Its IUPAC name is ethyl 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate.
| Compound Name | ethyl 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate |
|---|---|
| PubChem CID | 18546296 |
| Molecular Formula | C36H45F9O4S |
| Molecular Weight | 744.80 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | ethyl 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoate |
| SMILES | CCOC(=O)C(CCCCCCCCC1c2ccc(OC)cc2SCC1(C)c1ccc(OC)cc1)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H45F9O4S/c1-5-49-31(46)24(20-21-33(37,38)34(39,40)35(41,42)36(43,44)45)12-10-8-6-7-9-11-13-29-28-19-18-27(48-4)22-30(28)50-23-32(29,2)25-14-16-26(47-3)17-15-25/h14-19,22,24,29H,5-13,20-21,23H2,1-4H3 |
| InChIKey | CVOKWDAGXYHBMU-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.80 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|