C19H27F9O2 — CID 18546298
ethyl 7,7,8,8,9,9,10,10,10-nonafluoro-2-hept-6-enyldecanoate (PubChem CID 18546298) has the molecular formula C19H27F9O2 and a molecular weight of 458.41 g/mol. Its IUPAC name is ethyl 7,7,8,8,9,9,10,10,10-nonafluoro-2-hept-6-enyldecanoate.
| Compound Name | ethyl 7,7,8,8,9,9,10,10,10-nonafluoro-2-hept-6-enyldecanoate |
|---|---|
| PubChem CID | 18546298 |
| Molecular Formula | C19H27F9O2 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | ethyl 7,7,8,8,9,9,10,10,10-nonafluoro-2-hept-6-enyldecanoate |
| SMILES | C=CCCCCCC(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C19H27F9O2/c1-3-5-6-7-8-11-14(15(29)30-4-2)12-9-10-13-16(20,21)17(22,23)18(24,25)19(26,27)28/h3,14H,1,4-13H2,2H3 |
| InChIKey | VYGFFRHFQLNJCA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|