About 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide
2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide (PubChem CID 18546495) has the molecular formula C23H17F6NO
and a molecular weight of 437.38 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide |
| PubChem CID | 18546495 |
| Molecular Formula | C23H17F6NO |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide |
| SMILES | CN(C(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H17F6NO/c1-30(20-10-6-5-9-19(20)16-7-3-2-4-8-16)21(31)13-15-11-17(22(24,25)26)14-18(12-15)23(27,28)29/h2-12,14H,13H2,1H3 |
| InChIKey | YPDPPCHRJSBOBT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide (CID 18546495) is 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide is CN(C(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide?
The InChIKey is YPDPPCHRJSBOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F6NO/c1-30(20-10-6-5-9-19(20)16-7-3-2-4-8-16)21(31)13-15-11-17(22(24,25)26)14-18(12-15)23(27,28)29/h2-12,14H,13H2,1H3.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide?
2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide has a molecular weight of 437.38 g/mol, XLogP of 6.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(2-phenylphenyl)acetamide is sourced from PubChem (CID 18546495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).