About N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide
N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide (PubChem CID 18546543) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide |
| PubChem CID | 18546543 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(C)C1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C10H17NO5/c1-4-6(12)11(3)10-9(15)8(14)7(13)5(2)16-10/h4-5,7-10,13-15H,1H2,2-3H3 |
| InChIKey | JPGVCVMNWHRTCU-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide?
The IUPAC name of N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide (CID 18546543) is N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide.
What is the SMILES notation for N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide?
The canonical SMILES for N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide is C=CC(=O)N(C)C1OC(C)C(O)C(O)C1O.
What is the InChIKey of N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide?
The InChIKey is JPGVCVMNWHRTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5/c1-4-6(12)11(3)10-9(15)8(14)7(13)5(2)16-10/h4-5,7-10,13-15H,1H2,2-3H3.
What are the key properties of N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide?
N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide has a molecular weight of 231.25 g/mol, XLogP of -1.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(3,4,5-trihydroxy-6-methyloxan-2-yl)prop-2-enamide is sourced from PubChem (CID 18546543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).