About 3,3-bis(trifluoromethyl)dodecane-1,12-diamine
3,3-bis(trifluoromethyl)dodecane-1,12-diamine (PubChem CID 18546601) has the molecular formula C14H26F6N2
and a molecular weight of 336.36 g/mol. Its IUPAC name is 3,3-bis(trifluoromethyl)dodecane-1,12-diamine.
Molecular Properties
| Compound Name | 3,3-bis(trifluoromethyl)dodecane-1,12-diamine |
| PubChem CID | 18546601 |
| Molecular Formula | C14H26F6N2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3,3-bis(trifluoromethyl)dodecane-1,12-diamine |
| SMILES | NCCCCCCCCCC(CCN)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H26F6N2/c15-13(16,17)12(9-11-22,14(18,19)20)8-6-4-2-1-3-5-7-10-21/h1-11,21-22H2 |
| InChIKey | PEYRRFKVWQYNET-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(trifluoromethyl)dodecane-1,12-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(trifluoromethyl)dodecane-1,12-diamine?
The IUPAC name of 3,3-bis(trifluoromethyl)dodecane-1,12-diamine (CID 18546601) is 3,3-bis(trifluoromethyl)dodecane-1,12-diamine.
What is the SMILES notation for 3,3-bis(trifluoromethyl)dodecane-1,12-diamine?
The canonical SMILES for 3,3-bis(trifluoromethyl)dodecane-1,12-diamine is NCCCCCCCCCC(CCN)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3,3-bis(trifluoromethyl)dodecane-1,12-diamine?
The InChIKey is PEYRRFKVWQYNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F6N2/c15-13(16,17)12(9-11-22,14(18,19)20)8-6-4-2-1-3-5-7-10-21/h1-11,21-22H2.
What are the key properties of 3,3-bis(trifluoromethyl)dodecane-1,12-diamine?
3,3-bis(trifluoromethyl)dodecane-1,12-diamine has a molecular weight of 336.36 g/mol, XLogP of 4.53, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(trifluoromethyl)dodecane-1,12-diamine is sourced from PubChem (CID 18546601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).