C19H12F8N2O7 — CID 18546637
4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzaldehyde (PubChem CID 18546637) has the molecular formula C19H12F8N2O7 and a molecular weight of 532.30 g/mol. Its IUPAC name is 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzaldehyde.
| Compound Name | 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzaldehyde |
|---|---|
| PubChem CID | 18546637 |
| Molecular Formula | C19H12F8N2O7 |
| Molecular Weight | 532.30 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12F8N2O7/c20-16(21,9-35-13-4-1-11(8-30)2-5-13)18(24,25)19(26,27)17(22,23)10-36-15-6-3-12(28(31)32)7-14(15)29(33)34/h1-8H,9-10H2 |
| InChIKey | WAZVXAHMUXLDKA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|