About 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine
4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine (PubChem CID 18547059) has the molecular formula C20H38N2O
and a molecular weight of 322.54 g/mol. Its IUPAC name is 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine |
| PubChem CID | 18547059 |
| Molecular Formula | C20H38N2O |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.30 |
| IUPAC Name | 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine |
| SMILES | CC/C(C)=C(/C(C)(C)N1CCCCC1)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C20H38N2O/c1-7-17(2)18(19(3,4)21-11-9-8-10-12-21)20(5,6)22-13-15-23-16-14-22/h7-16H2,1-6H3/b18-17- |
| InChIKey | MFFHUCXINFZWQZ-ZCXUNETKSA-N |
| XLogP | 4.09 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine?
The IUPAC name of 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine (CID 18547059) is 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine.
What is the SMILES notation for 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine?
The canonical SMILES for 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine is CC/C(C)=C(/C(C)(C)N1CCCCC1)C(C)(C)N1CCOCC1.
What is the InChIKey of 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine?
The InChIKey is MFFHUCXINFZWQZ-ZCXUNETKSA-N. The full InChI is InChI=1S/C20H38N2O/c1-7-17(2)18(19(3,4)21-11-9-8-10-12-21)20(5,6)22-13-15-23-16-14-22/h7-16H2,1-6H3/b18-17-.
What are the key properties of 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine?
4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine has a molecular weight of 322.54 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2,4-dimethyl-3-(2-piperidin-1-ylpropan-2-yl)hex-3-en-2-yl]morpholine is sourced from PubChem (CID 18547059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).