About acetyl 2-acetyldodecanoate
acetyl 2-acetyldodecanoate (PubChem CID 18547339) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is acetyl 2-acetyldodecanoate.
Molecular Properties
| Compound Name | acetyl 2-acetyldodecanoate |
| PubChem CID | 18547339 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | acetyl 2-acetyldodecanoate |
| SMILES | CCCCCCCCCCC(C(C)=O)C(=O)OC(C)=O |
| InChI | InChI=1S/C16H28O4/c1-4-5-6-7-8-9-10-11-12-15(13(2)17)16(19)20-14(3)18/h15H,4-12H2,1-3H3 |
| InChIKey | KDGWCIWOCXGCQT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2-acetyldodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2-acetyldodecanoate?
The IUPAC name of acetyl 2-acetyldodecanoate (CID 18547339) is acetyl 2-acetyldodecanoate.
What is the SMILES notation for acetyl 2-acetyldodecanoate?
The canonical SMILES for acetyl 2-acetyldodecanoate is CCCCCCCCCCC(C(C)=O)C(=O)OC(C)=O.
What is the InChIKey of acetyl 2-acetyldodecanoate?
The InChIKey is KDGWCIWOCXGCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-4-5-6-7-8-9-10-11-12-15(13(2)17)16(19)20-14(3)18/h15H,4-12H2,1-3H3.
What are the key properties of acetyl 2-acetyldodecanoate?
acetyl 2-acetyldodecanoate has a molecular weight of 284.40 g/mol, XLogP of 3.81, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2-acetyldodecanoate is sourced from PubChem (CID 18547339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).