About 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one
1-(1,4-oxathian-4-ium-4-yl)heptan-2-one (PubChem CID 18547568) has the molecular formula C11H21O2S+
and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one.
Molecular Properties
| Compound Name | 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one |
| PubChem CID | 18547568 |
| Molecular Formula | C11H21O2S+ |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one |
| SMILES | CCCCCC(=O)C[S+]1CCOCC1 |
| InChI | InChI=1S/C11H21O2S/c1-2-3-4-5-11(12)10-14-8-6-13-7-9-14/h2-10H2,1H3/q+1 |
| InChIKey | FGSQAYAPDIFHOJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one?
The IUPAC name of 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one (CID 18547568) is 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one.
What is the SMILES notation for 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one?
The canonical SMILES for 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one is CCCCCC(=O)C[S+]1CCOCC1.
What is the InChIKey of 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one?
The InChIKey is FGSQAYAPDIFHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O2S/c1-2-3-4-5-11(12)10-14-8-6-13-7-9-14/h2-10H2,1H3/q+1.
What are the key properties of 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one?
1-(1,4-oxathian-4-ium-4-yl)heptan-2-one has a molecular weight of 217.35 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-oxathian-4-ium-4-yl)heptan-2-one is sourced from PubChem (CID 18547568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).