About 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate
1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate (PubChem CID 18547630) has the molecular formula C13H23F3O4S3
and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate |
| PubChem CID | 18547630 |
| Molecular Formula | C13H23F3O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate |
| SMILES | CCCCCCC(=O)C[S+]1CCSCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H23OS2.CHF3O3S/c1-2-3-4-5-6-12(13)11-15-9-7-14-8-10-15;2-1(3,4)8(5,6)7/h2-11H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UWRWMEYKOGWLPZ-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate?
The IUPAC name of 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate (CID 18547630) is 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate.
What is the SMILES notation for 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate?
The canonical SMILES for 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate is CCCCCCC(=O)C[S+]1CCSCC1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate?
The InChIKey is UWRWMEYKOGWLPZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23OS2.CHF3O3S/c1-2-3-4-5-6-12(13)11-15-9-7-14-8-10-15;2-1(3,4)8(5,6)7/h2-11H2,1H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate?
1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate has a molecular weight of 396.52 g/mol, XLogP of 2.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dithian-1-ium-1-yl)octan-2-one;trifluoromethanesulfonate is sourced from PubChem (CID 18547630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).