C15H21F9O4S3 — CID 18547779
1-(1,4-dithian-1-ium-1-yl)heptan-2-one;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 18547779) has the molecular formula C15H21F9O4S3 and a molecular weight of 532.51 g/mol. Its IUPAC name is 1-(1,4-dithian-1-ium-1-yl)heptan-2-one;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 1-(1,4-dithian-1-ium-1-yl)heptan-2-one;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 18547779 |
| Molecular Formula | C15H21F9O4S3 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 1-(1,4-dithian-1-ium-1-yl)heptan-2-one;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCC(=O)C[S+]1CCSCC1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H21OS2.C4HF9O3S/c1-2-3-4-5-11(12)10-14-8-6-13-7-9-14;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h2-10H2,1H3;(H,14,15,16)/q+1;/p-1 |
| InChIKey | UULAHALHLIMKQK-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|