About 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one
4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one (PubChem CID 18547942) has the molecular formula C17H26O5S2
and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one |
| PubChem CID | 18547942 |
| Molecular Formula | C17H26O5S2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one |
| SMILES | CCCCC(=O)C[S+]1CCOCC1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H19O2S.C7H8O3S/c1-2-3-4-10(11)9-13-7-5-12-6-8-13;1-6-2-4-7(5-3-6)11(8,9)10/h2-9H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | NEDBSBARSLUMGL-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one?
The IUPAC name of 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one (CID 18547942) is 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one.
What is the SMILES notation for 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one?
The canonical SMILES for 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one is CCCCC(=O)C[S+]1CCOCC1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one?
The InChIKey is NEDBSBARSLUMGL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H19O2S.C7H8O3S/c1-2-3-4-10(11)9-13-7-5-12-6-8-13;1-6-2-4-7(5-3-6)11(8,9)10/h2-9H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one?
4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one has a molecular weight of 374.52 g/mol, XLogP of 2.29, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;1-(1,4-oxathian-4-ium-4-yl)hexan-2-one is sourced from PubChem (CID 18547942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).