C17H14FN3O2 — CID 18548527
6-fluoro-2-[2-(hydroxymethyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548527) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 6-fluoro-2-[2-(hydroxymethyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 6-fluoro-2-[2-(hydroxymethyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548527 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-fluoro-2-[2-(hydroxymethyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccccc3CO)nc3cc(F)cc1c32 |
| InChI | InChI=1S/C17H14FN3O2/c18-11-7-13-15-14(8-11)20-16(21(15)6-5-19-17(13)23)12-4-2-1-3-10(12)9-22/h1-4,7-8,22H,5-6,9H2,(H,19,23) |
| InChIKey | XUZMVJIMCHUXTC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |