C22H24N4O — CID 18548549
2-[4-(1-methylpiperidin-3-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548549) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-(1-methylpiperidin-3-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(1-methylpiperidin-3-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548549 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[4-(1-methylpiperidin-3-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CN1CCCC(c2ccc(-c3nc4cccc5c4n3CCNC5=O)cc2)C1 |
| InChI | InChI=1S/C22H24N4O/c1-25-12-3-4-17(14-25)15-7-9-16(10-8-15)21-24-19-6-2-5-18-20(19)26(21)13-11-23-22(18)27/h2,5-10,17H,3-4,11-14H2,1H3,(H,23,27) |
| InChIKey | KNQIXAUBBOXOHK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |