C17H13N7O — CID 18548558
2-[4-(2H-tetrazol-5-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548558) has the molecular formula C17H13N7O and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[4-(2H-tetrazol-5-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(2H-tetrazol-5-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548558 |
| Molecular Formula | C17H13N7O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[4-(2H-tetrazol-5-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(-c4nn[nH]n4)cc3)nc3cccc1c32 |
| InChI | InChI=1S/C17H13N7O/c25-17-12-2-1-3-13-14(12)24(9-8-18-17)16(19-13)11-6-4-10(5-7-11)15-20-22-23-21-15/h1-7H,8-9H2,(H,18,25)(H,20,21,22,23) |
| InChIKey | OABPFWTVPGAFRX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |