C19H19FN4O — CID 18548599
2-[3-[(dimethylamino)methyl]phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548599) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-[3-[(dimethylamino)methyl]phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[3-[(dimethylamino)methyl]phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548599 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[3-[(dimethylamino)methyl]phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CN(C)Cc1cccc(-c2nc3cc(F)cc4c3n2CCNC4=O)c1 |
| InChI | InChI=1S/C19H19FN4O/c1-23(2)11-12-4-3-5-13(8-12)18-22-16-10-14(20)9-15-17(16)24(18)7-6-21-19(15)25/h3-5,8-10H,6-7,11H2,1-2H3,(H,21,25) |
| InChIKey | MGWNEJBRPPGBET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |