C23H22N4O2 — CID 18548619
2-[4-[[(5-methylfuran-2-yl)methylamino]methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548619) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[4-[[(5-methylfuran-2-yl)methylamino]methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-[[(5-methylfuran-2-yl)methylamino]methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548619 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[4-[[(5-methylfuran-2-yl)methylamino]methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | Cc1ccc(CNCc2ccc(-c3nc4cccc5c4n3CCNC5=O)cc2)o1 |
| InChI | InChI=1S/C23H22N4O2/c1-15-5-10-18(29-15)14-24-13-16-6-8-17(9-7-16)22-26-20-4-2-3-19-21(20)27(22)12-11-25-23(19)28/h2-10,24H,11-14H2,1H3,(H,25,28) |
| InChIKey | ZSKRMDLARGHVKF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |