C21H21FN4O2 — CID 18548655
6-fluoro-2-[4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548655) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 6-fluoro-2-[4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 6-fluoro-2-[4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548655 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-fluoro-2-[4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(CN4CCC(O)C4)cc3)nc3cc(F)cc1c32 |
| InChI | InChI=1S/C21H21FN4O2/c22-15-9-17-19-18(10-15)24-20(26(19)8-6-23-21(17)28)14-3-1-13(2-4-14)11-25-7-5-16(27)12-25/h1-4,9-10,16,27H,5-8,11-12H2,(H,23,28) |
| InChIKey | KRSDFODCIWCRTR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |