C21H23N3O2 — CID 18548663
2-[4-(1-hydroxy-3-methylbutyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 18548663) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[4-(1-hydroxy-3-methylbutyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(1-hydroxy-3-methylbutyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 18548663 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[4-(1-hydroxy-3-methylbutyl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CC(C)CC(O)c1ccc(-c2nc3cccc4c3n2CCNC4=O)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-13(2)12-18(25)14-6-8-15(9-7-14)20-23-17-5-3-4-16-19(17)24(20)11-10-22-21(16)26/h3-9,13,18,25H,10-12H2,1-2H3,(H,22,26) |
| InChIKey | OVKXHAWWWQZOEZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |