C16H17Cl2N5S — CID 18549029
N-[6,7-dichloro-3-(1,3-thiazol-2-yl)quinoxalin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 18549029) has the molecular formula C16H17Cl2N5S and a molecular weight of 382.32 g/mol. Its IUPAC name is N-[6,7-dichloro-3-(1,3-thiazol-2-yl)quinoxalin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6,7-dichloro-3-(1,3-thiazol-2-yl)quinoxalin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 18549029 |
| Molecular Formula | C16H17Cl2N5S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[6,7-dichloro-3-(1,3-thiazol-2-yl)quinoxalin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc2cc(Cl)c(Cl)cc2nc1-c1nccs1 |
| InChI | InChI=1S/C16H17Cl2N5S/c1-23(2)6-3-4-19-15-14(16-20-5-7-24-16)21-12-8-10(17)11(18)9-13(12)22-15/h5,7-9H,3-4,6H2,1-2H3,(H,19,22) |
| InChIKey | UXCSUMZSIFCEDV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|