C20H25N5O4S2 — CID 18550408
4-[[4-carbamoyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid (PubChem CID 18550408) has the molecular formula C20H25N5O4S2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 4-[[4-carbamoyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[4-carbamoyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 18550408 |
| Molecular Formula | C20H25N5O4S2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 4-[[4-carbamoyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
| SMILES | NC(=O)c1c(C(S)c2ccc(C(=O)O)cc2)nsc1NC(=O)NCCCN1CCCC1 |
| InChI | InChI=1S/C20H25N5O4S2/c21-17(26)14-15(16(30)12-4-6-13(7-5-12)19(27)28)24-31-18(14)23-20(29)22-8-3-11-25-9-1-2-10-25/h4-7,16,30H,1-3,8-11H2,(H2,21,26)(H,27,28)(H2,22,23,29) |
| InChIKey | IDJANVSPTBODDA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|