C17H21N5O4S2 — CID 18550430
3-[[4-carbamoyl-5-[2-(dimethylamino)ethylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid (PubChem CID 18550430) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-[[4-carbamoyl-5-[2-(dimethylamino)ethylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid.
| Compound Name | 3-[[4-carbamoyl-5-[2-(dimethylamino)ethylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 18550430 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-[[4-carbamoyl-5-[2-(dimethylamino)ethylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
| SMILES | CN(C)CCNC(=O)Nc1snc(C(S)c2cccc(C(=O)O)c2)c1C(N)=O |
| InChI | InChI=1S/C17H21N5O4S2/c1-22(2)7-6-19-17(26)20-15-11(14(18)23)12(21-28-15)13(27)9-4-3-5-10(8-9)16(24)25/h3-5,8,13,27H,6-7H2,1-2H3,(H2,18,23)(H,24,25)(H2,19,20,26) |
| InChIKey | GDTQVDCNDRNZOJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|