C20H16F2N4O4S2 — CID 18550434
3-[[4-carbamoyl-5-[(3,4-difluorophenyl)methylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid (PubChem CID 18550434) has the molecular formula C20H16F2N4O4S2 and a molecular weight of 478.50 g/mol. Its IUPAC name is 3-[[4-carbamoyl-5-[(3,4-difluorophenyl)methylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid.
| Compound Name | 3-[[4-carbamoyl-5-[(3,4-difluorophenyl)methylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 18550434 |
| Molecular Formula | C20H16F2N4O4S2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 3-[[4-carbamoyl-5-[(3,4-difluorophenyl)methylcarbamoylamino]-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
| SMILES | NC(=O)c1c(C(S)c2cccc(C(=O)O)c2)nsc1NC(=O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N4O4S2/c21-12-5-4-9(6-13(12)22)8-24-20(30)25-18-14(17(23)27)15(26-32-18)16(31)10-2-1-3-11(7-10)19(28)29/h1-7,16,31H,8H2,(H2,23,27)(H,28,29)(H2,24,25,30) |
| InChIKey | ZDHAHMADMJCUBJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|