C14H23N3O5S2 — CID 18550544
5-(2,3-dihydroxypropylcarbamoylamino)-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid (PubChem CID 18550544) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylcarbamoylamino)-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-(2,3-dihydroxypropylcarbamoylamino)-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550544 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 5-(2,3-dihydroxypropylcarbamoylamino)-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid |
| SMILES | CCCCCCSc1nsc(NC(=O)NCC(O)CO)c1C(=O)O |
| InChI | InChI=1S/C14H23N3O5S2/c1-2-3-4-5-6-23-12-10(13(20)21)11(24-17-12)16-14(22)15-7-9(19)8-18/h9,18-19H,2-8H2,1H3,(H,20,21)(H2,15,16,22) |
| InChIKey | NRZQIGMZIRUBJE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|