C16H18N4O5S2 — CID 18550908
3-[[4-carbamoyl-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid (PubChem CID 18550908) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[[4-carbamoyl-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid.
| Compound Name | 3-[[4-carbamoyl-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 18550908 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-[[4-carbamoyl-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
| SMILES | NC(=O)c1c(C(S)c2cccc(C(=O)O)c2)nsc1NC(=O)NCCCO |
| InChI | InChI=1S/C16H18N4O5S2/c17-13(22)10-11(12(26)8-3-1-4-9(7-8)15(23)24)20-27-14(10)19-16(25)18-5-2-6-21/h1,3-4,7,12,21,26H,2,5-6H2,(H2,17,22)(H,23,24)(H2,18,19,25) |
| InChIKey | XMSYAUZSBFVGOA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|