About N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide
N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide (PubChem CID 18551162) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide.
Molecular Properties
| Compound Name | N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide |
| PubChem CID | 18551162 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide |
| SMILES | Cc1noc(=O)c2ccc(NC(=O)C(=O)CC3(c4ccccc4)CCC3)cc12 |
| InChI | InChI=1S/C22H20N2O4/c1-14-18-12-16(8-9-17(18)21(27)28-24-14)23-20(26)19(25)13-22(10-5-11-22)15-6-3-2-4-7-15/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,23,26) |
| InChIKey | VPZWZQQXNOSXJD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide?
The IUPAC name of N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide (CID 18551162) is N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide.
What is the SMILES notation for N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide?
The canonical SMILES for N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide is Cc1noc(=O)c2ccc(NC(=O)C(=O)CC3(c4ccccc4)CCC3)cc12.
What is the InChIKey of N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide?
The InChIKey is VPZWZQQXNOSXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-14-18-12-16(8-9-17(18)21(27)28-24-14)23-20(26)19(25)13-22(10-5-11-22)15-6-3-2-4-7-15/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,23,26).
What are the key properties of N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide?
N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide has a molecular weight of 376.41 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-oxo-3-(1-phenylcyclobutyl)propanamide is sourced from PubChem (CID 18551162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).