C24H46N4 — CID 18551436
2,4,6-tributyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine (PubChem CID 18551436) has the molecular formula C24H46N4 and a molecular weight of 390.66 g/mol. Its IUPAC name is 2,4,6-tributyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine.
| Compound Name | 2,4,6-tributyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 18551436 |
| Molecular Formula | C24H46N4 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.37 |
| IUPAC Name | 2,4,6-tributyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine |
| SMILES | CCCCC1=NC(CCCC)N(C2CC(C)(C)NC(C)(C)C2)C(CCCC)=N1 |
| InChI | InChI=1S/C24H46N4/c1-8-11-14-20-25-21(15-12-9-2)28(22(26-20)16-13-10-3)19-17-23(4,5)27-24(6,7)18-19/h19,21,27H,8-18H2,1-7H3 |
| InChIKey | JTMLBTIZPQHJCX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |