About 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid
2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid (PubChem CID 18551585) has the molecular formula C15H20N2O4S3
and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid.
Molecular Properties
| Compound Name | 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid |
| PubChem CID | 18551585 |
| Molecular Formula | C15H20N2O4S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid |
| SMILES | CCCCCSc1nc2ccc(S(=O)(=O)NC(C)C(=O)O)cc2s1 |
| InChI | InChI=1S/C15H20N2O4S3/c1-3-4-5-8-22-15-16-12-7-6-11(9-13(12)23-15)24(20,21)17-10(2)14(18)19/h6-7,9-10,17H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | IMOZVSGWWWIEEH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid?
The IUPAC name of 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid (CID 18551585) is 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid.
What is the SMILES notation for 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid?
The canonical SMILES for 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid is CCCCCSc1nc2ccc(S(=O)(=O)NC(C)C(=O)O)cc2s1.
What is the InChIKey of 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid?
The InChIKey is IMOZVSGWWWIEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O4S3/c1-3-4-5-8-22-15-16-12-7-6-11(9-13(12)23-15)24(20,21)17-10(2)14(18)19/h6-7,9-10,17H,3-5,8H2,1-2H3,(H,18,19).
What are the key properties of 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid?
2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid has a molecular weight of 388.54 g/mol, XLogP of 3.33, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid is sourced from PubChem (CID 18551585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).