C23H38N2O2 — CID 18551870
1-isocyanato-4-[(4-isocyanato-2,3,5,6-tetramethylcyclohexyl)methyl]-2,3,5,6-tetramethylcyclohexane (PubChem CID 18551870) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-isocyanato-4-[(4-isocyanato-2,3,5,6-tetramethylcyclohexyl)methyl]-2,3,5,6-tetramethylcyclohexane.
| Compound Name | 1-isocyanato-4-[(4-isocyanato-2,3,5,6-tetramethylcyclohexyl)methyl]-2,3,5,6-tetramethylcyclohexane |
|---|---|
| PubChem CID | 18551870 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanato-2,3,5,6-tetramethylcyclohexyl)methyl]-2,3,5,6-tetramethylcyclohexane |
| SMILES | CC1C(C)C(N=C=O)C(C)C(C)C1CC1C(C)C(C)C(N=C=O)C(C)C1C |
| InChI | InChI=1S/C23H38N2O2/c1-12-16(5)22(24-10-26)17(6)13(2)20(12)9-21-14(3)18(7)23(25-11-27)19(8)15(21)4/h12-23H,9H2,1-8H3 |
| InChIKey | OLQWATZTZRLIPF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|