About 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine
3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine (PubChem CID 18551970) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine.
Molecular Properties
| Compound Name | 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine |
| PubChem CID | 18551970 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine |
| SMILES | COc1c(N(C)C)ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O3/c1-10(2)6-4-5-9-8(11(12)13)7(6)14-3/h4-5H,1-3H3 |
| InChIKey | FEPWPPKFGNIYSQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine?
The IUPAC name of 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine (CID 18551970) is 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine.
What is the SMILES notation for 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine?
The canonical SMILES for 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine is COc1c(N(C)C)ccnc1[N+](=O)[O-].
What is the InChIKey of 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine?
The InChIKey is FEPWPPKFGNIYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-10(2)6-4-5-9-8(11(12)13)7(6)14-3/h4-5H,1-3H3.
What are the key properties of 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine?
3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine has a molecular weight of 197.19 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-dimethyl-2-nitropyridin-4-amine is sourced from PubChem (CID 18551970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).