About 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate
2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate (PubChem CID 18552000) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate |
| PubChem CID | 18552000 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate |
| SMILES | C=C(CCC(CO)OCC(C)O)C(=O)OCC(C)C |
| InChI | InChI=1S/C14H26O5/c1-10(2)8-19-14(17)11(3)5-6-13(7-15)18-9-12(4)16/h10,12-13,15-16H,3,5-9H2,1-2,4H3 |
| InChIKey | DJNDRHOQPJNECF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate?
The IUPAC name of 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate (CID 18552000) is 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate.
What is the SMILES notation for 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate?
The canonical SMILES for 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate is C=C(CCC(CO)OCC(C)O)C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate?
The InChIKey is DJNDRHOQPJNECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5/c1-10(2)8-19-14(17)11(3)5-6-13(7-15)18-9-12(4)16/h10,12-13,15-16H,3,5-9H2,1-2,4H3.
What are the key properties of 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate?
2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate has a molecular weight of 274.36 g/mol, XLogP of 1.28, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 6-hydroxy-5-(2-hydroxypropoxy)-2-methylidenehexanoate is sourced from PubChem (CID 18552000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).