About N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride
N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride (PubChem CID 18552131) has the molecular formula C13H15ClN4O2
and a molecular weight of 294.74 g/mol. Its IUPAC name is N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride.
Molecular Properties
| Compound Name | N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride |
| PubChem CID | 18552131 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride |
| SMILES | Nc1ccc(N(O)C(=O)C[n+]2ccccc2)c(N)c1.[Cl-] |
| InChI | InChI=1S/C13H15N4O2.ClH/c14-10-4-5-12(11(15)8-10)17(19)13(18)9-16-6-2-1-3-7-16;/h1-8,19H,9,14-15H2;1H/q+1;/p-1 |
| InChIKey | ULNZWLHRFIIUII-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride?
The IUPAC name of N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride (CID 18552131) is N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride.
What is the SMILES notation for N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride?
The canonical SMILES for N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride is Nc1ccc(N(O)C(=O)C[n+]2ccccc2)c(N)c1.[Cl-].
What is the InChIKey of N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride?
The InChIKey is ULNZWLHRFIIUII-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H15N4O2.ClH/c14-10-4-5-12(11(15)8-10)17(19)13(18)9-16-6-2-1-3-7-16;/h1-8,19H,9,14-15H2;1H/q+1;/p-1.
What are the key properties of N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride?
N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride has a molecular weight of 294.74 g/mol, XLogP of -2.44, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-diaminophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide chloride is sourced from PubChem (CID 18552131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).