C24H20N2O3 — CID 18552523
5-benzhydryl-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 18552523) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-benzhydryl-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-benzhydryl-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18552523 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-benzhydryl-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccccc1N1C(=O)NC(=O)C(C(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20N2O3/c1-16-10-8-9-15-19(16)26-23(28)21(22(27)25-24(26)29)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-15,20-21H,1H3,(H,25,27,29) |
| InChIKey | DNPUMLAWJVRBIN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|