C21H23BrF2N2O4S — CID 18553093
3-[4-(difluoromethoxy)phenyl]-1-(2,5-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide (PubChem CID 18553093) has the molecular formula C21H23BrF2N2O4S and a molecular weight of 517.39 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-(2,5-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-(2,5-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 18553093 |
| Molecular Formula | C21H23BrF2N2O4S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-(2,5-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide |
| SMILES | COc1ccc(OC)c(N2CC(O)(c3ccc(OC(F)F)cc3)[N+]3=C2SCCC3)c1.[Br-] |
| InChI | InChI=1S/C21H23F2N2O4S.BrH/c1-27-16-8-9-18(28-2)17(12-16)24-13-21(26,25-10-3-11-30-20(24)25)14-4-6-15(7-5-14)29-19(22)23;/h4-9,12,19,26H,3,10-11,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LELRABNWYGBPER-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|