C19H21BrN2OS — CID 18553149
1-(3-methylphenyl)-3-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide (PubChem CID 18553149) has the molecular formula C19H21BrN2OS and a molecular weight of 405.36 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide.
| Compound Name | 1-(3-methylphenyl)-3-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 18553149 |
| Molecular Formula | C19H21BrN2OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 1-(3-methylphenyl)-3-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol bromide |
| SMILES | Cc1cccc(N2CC(O)(c3ccccc3)[N+]3=C2SCCC3)c1.[Br-] |
| InChI | InChI=1S/C19H21N2OS.BrH/c1-15-7-5-10-17(13-15)20-14-19(22,16-8-3-2-4-9-16)21-11-6-12-23-18(20)21;/h2-5,7-10,13,22H,6,11-12,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | RHBXCTCZBBARQG-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|