C23H29BrN2O2 — CID 18553260
3-(4-ethoxyphenyl)-1-(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide (PubChem CID 18553260) has the molecular formula C23H29BrN2O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide.
| Compound Name | 3-(4-ethoxyphenyl)-1-(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 18553260 |
| Molecular Formula | C23H29BrN2O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
| SMILES | CCOc1ccc(C2(O)CN(c3ccc(C)cc3)C3=[N+]2CCCCC3)cc1.[Br-] |
| InChI | InChI=1S/C23H29N2O2.BrH/c1-3-27-21-14-10-19(11-15-21)23(26)17-24(20-12-8-18(2)9-13-20)22-7-5-4-6-16-25(22)23;/h8-15,26H,3-7,16-17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PXBJQZZOKPFYDG-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|